About N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide
N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide (PubChem CID 5193847) has the molecular formula C20H30N2O4
and a molecular weight of 362.47 g/mol. Its IUPAC name is N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide.
Molecular Properties
| Compound Name | N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide |
| PubChem CID | 5193847 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide |
| SMILES | COc1ccc(CCNC(=O)CCC(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C20H30N2O4/c1-25-17-9-8-15(14-18(17)26-2)12-13-21-19(23)10-11-20(24)22-16-6-4-3-5-7-16/h8-9,14,16H,3-7,10-13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | RBLNMKYMZYCJBS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide?
The IUPAC name of N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide (CID 5193847) is N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide.
What is the SMILES notation for N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide?
The canonical SMILES for N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide is COc1ccc(CCNC(=O)CCC(=O)NC2CCCCC2)cc1OC.
What is the InChIKey of N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide?
The InChIKey is RBLNMKYMZYCJBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O4/c1-25-17-9-8-15(14-18(17)26-2)12-13-21-19(23)10-11-20(24)22-16-6-4-3-5-7-16/h8-9,14,16H,3-7,10-13H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide?
N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide has a molecular weight of 362.47 g/mol, XLogP of 2.59, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide is sourced from PubChem (CID 5193847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).