C20H20FN5O2 — CID 51938666
3-(carbamoylamino)-N-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]benzamide (PubChem CID 51938666) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]benzamide.
| Compound Name | 3-(carbamoylamino)-N-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 51938666 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-(carbamoylamino)-N-[(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]benzamide |
| SMILES | Cc1c([C@H](C)NC(=O)c2cccc(NC(N)=O)c2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN5O2/c1-12(24-19(27)14-4-3-5-16(10-14)25-20(22)28)18-11-23-26(13(18)2)17-8-6-15(21)7-9-17/h3-12H,1-2H3,(H,24,27)(H3,22,25,28)/t12-/m0/s1 |
| InChIKey | OJUGZAUSCYZUFE-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |