C19H20F3N3O2 — CID 51938691
(E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide (PubChem CID 51938691) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is (E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 51938691 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=C/C(=O)NCCNc2ccc(C(F)(F)F)cn2)o1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-12-10-15(12)16-5-3-14(27-16)4-7-18(26)24-9-8-23-17-6-2-13(11-25-17)19(20,21)22/h2-7,11-12,15H,8-10H2,1H3,(H,23,25)(H,24,26)/b7-4+/t12-,15-/m1/s1 |
| InChIKey | SAFANHMHZUUXOU-NJKKUKIKSA-N |
| XLogP | 4.06 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|