C43H64O10 — CID 5194
6'-cyclohexyl-24-hydroxy-12-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one (PubChem CID 5194) has the molecular formula C43H64O10 and a molecular weight of 740.98 g/mol. Its IUPAC name is 6'-cyclohexyl-24-hydroxy-12-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one.
| Compound Name | 6'-cyclohexyl-24-hydroxy-12-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
|---|---|
| PubChem CID | 5194 |
| Molecular Formula | C43H64O10 |
| Molecular Weight | 740.98 g/mol |
| Exact Mass | 740.45 |
| IUPAC Name | 6'-cyclohexyl-24-hydroxy-12-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
| SMILES | COC1CC(OC2C(C)=CCC3CC(CC4(CCC(C)C(C5CCCCC5)O4)O3)OC(=O)C3C=C(C)CC4OCC(=CC=CC2C)C43O)OC(C)C1O |
| InChI | InChI=1S/C43H64O10/c1-25-19-34-41(45)50-33-21-32(52-42(23-33)18-17-28(4)40(53-42)30-12-8-7-9-13-30)16-15-27(3)39(51-37-22-35(47-6)38(44)29(5)49-37)26(2)11-10-14-31-24-48-36(20-25)43(31,34)46/h10-11,14-15,19,26,28-30,32-40,44,46H,7-9,12-13,16-18,20-24H2,1-6H3 |
| InChIKey | LNASWLBIATYITH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.98 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|