C21H26N2O5S — CID 51940592
(2S,4R)-1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 51940592) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is (2S,4R)-1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4R)-1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 51940592 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2S,4R)-1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N2c3ccccc3[C@H](C(N)=O)C[C@@H]2C)cc1C |
| InChI | InChI=1S/C21H26N2O5S/c1-14-12-16(8-9-20(14)28-11-10-27-3)29(25,26)23-15(2)13-18(21(22)24)17-6-4-5-7-19(17)23/h4-9,12,15,18H,10-11,13H2,1-3H3,(H2,22,24)/t15-,18+/m0/s1 |
| InChIKey | UOLJEDSCJRIYGM-MAUKXSAKSA-N |
| XLogP | 2.58 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|