About (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol
(1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol (PubChem CID 51941193) has the molecular formula C19H23F2NO
and a molecular weight of 319.40 g/mol. Its IUPAC name is (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol |
| PubChem CID | 51941193 |
| Molecular Formula | C19H23F2NO |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol |
| SMILES | CC(C)(C)c1ccc(CNC[C@H](O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H23F2NO/c1-19(2,3)14-6-4-13(5-7-14)11-22-12-18(23)16-9-8-15(20)10-17(16)21/h4-10,18,22-23H,11-12H2,1-3H3/t18-/m0/s1 |
| InChIKey | UIMQVTQYGDWWAD-SFHVURJKSA-N |
| XLogP | 4.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol?
The IUPAC name of (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol (CID 51941193) is (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol.
What is the SMILES notation for (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol?
The canonical SMILES for (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol is CC(C)(C)c1ccc(CNC[C@H](O)c2ccc(F)cc2F)cc1.
What is the InChIKey of (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol?
The InChIKey is UIMQVTQYGDWWAD-SFHVURJKSA-N. The full InChI is InChI=1S/C19H23F2NO/c1-19(2,3)14-6-4-13(5-7-14)11-22-12-18(23)16-9-8-15(20)10-17(16)21/h4-10,18,22-23H,11-12H2,1-3H3/t18-/m0/s1.
What are the key properties of (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol?
(1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol has a molecular weight of 319.40 g/mol, XLogP of 4.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[(4-tert-butylphenyl)methylamino]-1-(2,4-difluorophenyl)ethanol is sourced from PubChem (CID 51941193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).