C16H19N3O5S — CID 51942411
N-[2-[[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 51942411) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[2-[[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51942411 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[2-[[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | C[C@H](NC(=O)CNC(=O)c1ccco1)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H19N3O5S/c1-11(12-5-3-6-13(9-12)19-25(2,22)23)18-15(20)10-17-16(21)14-7-4-8-24-14/h3-9,11,19H,10H2,1-2H3,(H,17,21)(H,18,20)/t11-/m0/s1 |
| InChIKey | GATOGTINPDCDEA-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |