C18H19N5O2S2 — CID 51943012
4-methyl-2-[[(2R)-2-methyl-5-nitro-2,3-dihydroindol-1-yl]methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 51943012) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 4-methyl-2-[[(2R)-2-methyl-5-nitro-2,3-dihydroindol-1-yl]methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-methyl-2-[[(2R)-2-methyl-5-nitro-2,3-dihydroindol-1-yl]methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 51943012 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-methyl-2-[[(2R)-2-methyl-5-nitro-2,3-dihydroindol-1-yl]methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | C[C@@H]1Cc2cc([N+](=O)[O-])ccc2N1Cn1nc(Cc2cccs2)n(C)c1=S |
| InChI | InChI=1S/C18H19N5O2S2/c1-12-8-13-9-14(23(24)25)5-6-16(13)21(12)11-22-18(26)20(2)17(19-22)10-15-4-3-7-27-15/h3-7,9,12H,8,10-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | GSDSTEXTGLLDRY-GFCCVEGCSA-N |
| XLogP | 3.92 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|