C22H26N4O3S — CID 51943069
N-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-phenylquinazolin-4-amine (PubChem CID 51943069) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-phenylquinazolin-4-amine.
| Compound Name | N-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 51943069 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-phenylquinazolin-4-amine |
| SMILES | C[C@@H]1CN(S(=O)(=O)CCNc2nc(-c3ccccc3)nc3ccccc23)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H26N4O3S/c1-16-14-26(15-17(2)29-16)30(27,28)13-12-23-22-19-10-6-7-11-20(19)24-21(25-22)18-8-4-3-5-9-18/h3-11,16-17H,12-15H2,1-2H3,(H,23,24,25)/t16-,17-/m1/s1 |
| InChIKey | SEAPQEPLXWHGHI-IAGOWNOFSA-N |
| XLogP | 3.15 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |