About N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide
N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide (PubChem CID 5194408) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide |
| PubChem CID | 5194408 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide |
| SMILES | CC1=CC(=NNC(=O)c2cccs2)CC(C)(C)C1 |
| InChI | InChI=1S/C14H18N2OS/c1-10-7-11(9-14(2,3)8-10)15-16-13(17)12-5-4-6-18-12/h4-7H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | JIKXSVJEBSOWSR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide?
The IUPAC name of N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide (CID 5194408) is N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide.
What is the SMILES notation for N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide?
The canonical SMILES for N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide is CC1=CC(=NNC(=O)c2cccs2)CC(C)(C)C1.
What is the InChIKey of N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide?
The InChIKey is JIKXSVJEBSOWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-10-7-11(9-14(2,3)8-10)15-16-13(17)12-5-4-6-18-12/h4-7H,8-9H2,1-3H3,(H,16,17).
What are the key properties of N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide?
N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide has a molecular weight of 262.38 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiophene-2-carboxamide is sourced from PubChem (CID 5194408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).