C22H27N3O2 — CID 51945239
1-[(R)-cyclopropyl-(4-methoxyphenyl)methyl]-3-(2-pyrrolidin-1-ylphenyl)urea (PubChem CID 51945239) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(4-methoxyphenyl)methyl]-3-(2-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1-[(R)-cyclopropyl-(4-methoxyphenyl)methyl]-3-(2-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 51945239 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-[(R)-cyclopropyl-(4-methoxyphenyl)methyl]-3-(2-pyrrolidin-1-ylphenyl)urea |
| SMILES | COc1ccc([C@H](NC(=O)Nc2ccccc2N2CCCC2)C2CC2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-27-18-12-10-17(11-13-18)21(16-8-9-16)24-22(26)23-19-6-2-3-7-20(19)25-14-4-5-15-25/h2-3,6-7,10-13,16,21H,4-5,8-9,14-15H2,1H3,(H2,23,24,26)/t21-/m1/s1 |
| InChIKey | XFFAQMCGZNBWHP-OAQYLSRUSA-N |
| XLogP | 4.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |