C17H27N3O5S — CID 51945406
1-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea (PubChem CID 51945406) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 51945406 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea |
| SMILES | CCOc1ccc(NC(=O)N[C@@H](C)CO)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H27N3O5S/c1-3-25-15-8-7-14(19-17(22)18-13(2)12-21)11-16(15)26(23,24)20-9-5-4-6-10-20/h7-8,11,13,21H,3-6,9-10,12H2,1-2H3,(H2,18,19,22)/t13-/m0/s1 |
| InChIKey | POCHWCMCTKZPDU-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |