C36H44CoN4 — CID 519459
cobalt(2+);2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide (PubChem CID 519459) has the molecular formula C36H44CoN4 and a molecular weight of 591.71 g/mol. Its IUPAC name is cobalt(2+);2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide.
| Compound Name | cobalt(2+);2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 519459 |
| Molecular Formula | C36H44CoN4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | cobalt(2+);2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Co+2] |
| InChI | InChI=1S/C36H44N4.Co/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | CILRATIHXSICFS-XTPDIVBZSA-N |
| XLogP | 9.28 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |