C18H26N4O3S — CID 51947252
N-[[6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 51947252) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[[6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[[6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 51947252 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[[6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | C[C@H]1CN(c2ccc(CNC(=O)CCN3CCSC3=O)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H26N4O3S/c1-13-11-22(12-14(2)25-13)16-4-3-15(9-19-16)10-20-17(23)5-6-21-7-8-26-18(21)24/h3-4,9,13-14H,5-8,10-12H2,1-2H3,(H,20,23)/t13-,14-/m0/s1 |
| InChIKey | LOQFDYYWSFSHQO-KBPBESRZSA-N |
| XLogP | 1.87 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|