About CID 5194777
CID 5194777 (PubChem CID 5194777) has the molecular formula C8H4S10Zn-2
and a molecular weight of 486.18 g/mol.
Molecular Properties
| Compound Name | CID 5194777 |
| PubChem CID | 5194777 |
| Molecular Formula | C8H4S10Zn-2 |
| Molecular Weight | 486.18 g/mol |
| Exact Mass | 483.68 |
| IUPAC Name | — |
| SMILES | [S-]C1SC2=C(S[CH-]S2)S1.[S-]C1SC2=C(S[CH-]S2)S1.[Zn+2] |
| InChI | InChI=1S/2C4H3S5.Zn/c2*5-4-8-2-3(9-4)7-1-6-2;/h2*1,4-5H;/q2*-1;+2/p-2 |
| InChIKey | CGCZUOZMNMMKOP-UHFFFAOYSA-L |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.18 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 5194777 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5194777?
The IUPAC name of CID 5194777 (CID 5194777) is not available.
What is the SMILES notation for CID 5194777?
The canonical SMILES for CID 5194777 is [S-]C1SC2=C(S[CH-]S2)S1.[S-]C1SC2=C(S[CH-]S2)S1.[Zn+2].
What is the InChIKey of CID 5194777?
The InChIKey is CGCZUOZMNMMKOP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H3S5.Zn/c2*5-4-8-2-3(9-4)7-1-6-2;/h2*1,4-5H;/q2*-1;+2/p-2.
What are the key properties of CID 5194777?
CID 5194777 has a molecular weight of 486.18 g/mol, XLogP of 6.04, 0 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5194777 is sourced from PubChem (CID 5194777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).