C26H37N5O3S — CID 51950072
N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-4-[[2-[(5R)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzamide (PubChem CID 51950072) has the molecular formula C26H37N5O3S and a molecular weight of 499.68 g/mol. Its IUPAC name is N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-4-[[2-[(5R)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzamide.
| Compound Name | N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-4-[[2-[(5R)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 51950072 |
| Molecular Formula | C26H37N5O3S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-4-[[2-[(5R)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzamide |
| SMILES | C[C@H]1CCCCN1CCCCNC(=O)c1ccc(NC(=O)C[C@H]2SC(N3CCCC3)=NC2=O)cc1 |
| InChI | InChI=1S/C26H37N5O3S/c1-19-8-2-4-14-30(19)15-5-3-13-27-24(33)20-9-11-21(12-10-20)28-23(32)18-22-25(34)29-26(35-22)31-16-6-7-17-31/h9-12,19,22H,2-8,13-18H2,1H3,(H,27,33)(H,28,32)/t19-,22+/m0/s1 |
| InChIKey | XSVNMCMUTASMJT-SIKLNZKXSA-N |
| XLogP | 3.49 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|