About 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one
6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 5195017) has the molecular formula C30H20BrNO2
and a molecular weight of 506.40 g/mol. Its IUPAC name is 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| PubChem CID | 5195017 |
| Molecular Formula | C30H20BrNO2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | O=C(C=Cc1ccc2c3c(cccc13)CC2)c1c(-c2ccccc2)c2cc(Br)ccc2[nH]c1=O |
| InChI | InChI=1S/C30H20BrNO2/c31-22-14-15-25-24(17-22)28(19-5-2-1-3-6-19)29(30(34)32-25)26(33)16-13-18-9-10-21-12-11-20-7-4-8-23(18)27(20)21/h1-10,13-17H,11-12H2,(H,32,34) |
| InChIKey | FWCLGLHAEYXRJT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
The IUPAC name of 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (CID 5195017) is 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
What is the SMILES notation for 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
The canonical SMILES for 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one is O=C(C=Cc1ccc2c3c(cccc13)CC2)c1c(-c2ccccc2)c2cc(Br)ccc2[nH]c1=O.
What is the InChIKey of 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
The InChIKey is FWCLGLHAEYXRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H20BrNO2/c31-22-14-15-25-24(17-22)28(19-5-2-1-3-6-19)29(30(34)32-25)26(33)16-13-18-9-10-21-12-11-20-7-4-8-23(18)27(20)21/h1-10,13-17H,11-12H2,(H,32,34).
What are the key properties of 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one?
6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one has a molecular weight of 506.40 g/mol, XLogP of 7.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[3-(1,2-dihydroacenaphthylen-5-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one is sourced from PubChem (CID 5195017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).