About 2-(2,5-dioxopyrrol-1-yl)ethylazanium
2-(2,5-dioxopyrrol-1-yl)ethylazanium (PubChem CID 5195065) has the molecular formula C6H9N2O2+
and a molecular weight of 141.15 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethylazanium.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethylazanium |
| PubChem CID | 5195065 |
| Molecular Formula | C6H9N2O2+ |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethylazanium |
| SMILES | [NH3+]CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H8N2O2/c7-3-4-8-5(9)1-2-6(8)10/h1-2H,3-4,7H2/p+1 |
| InChIKey | ODVRLSOMTXGTMX-UHFFFAOYSA-O |
| XLogP | -1.85 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethylazanium?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethylazanium (CID 5195065) is 2-(2,5-dioxopyrrol-1-yl)ethylazanium.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)ethylazanium?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)ethylazanium is [NH3+]CCN1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)ethylazanium?
The InChIKey is ODVRLSOMTXGTMX-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N2O2/c7-3-4-8-5(9)1-2-6(8)10/h1-2H,3-4,7H2/p+1.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)ethylazanium?
2-(2,5-dioxopyrrol-1-yl)ethylazanium has a molecular weight of 141.15 g/mol, XLogP of -1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)ethylazanium is sourced from PubChem (CID 5195065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).