C19H27N3O2 — CID 5195107
2-N,5-N-dicyclohexylpyridine-2,5-dicarboxamide (PubChem CID 5195107) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-N,5-N-dicyclohexylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-dicyclohexylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 5195107 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-N,5-N-dicyclohexylpyridine-2,5-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(C(=O)NC2CCCCC2)nc1 |
| InChI | InChI=1S/C19H27N3O2/c23-18(21-15-7-3-1-4-8-15)14-11-12-17(20-13-14)19(24)22-16-9-5-2-6-10-16/h11-13,15-16H,1-10H2,(H,21,23)(H,22,24) |
| InChIKey | HLJMETNMHHOUGR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |