C16H16ClN5O3 — CID 51951606
5-chloro-1,3-dimethyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyrazole-4-carboxamide (PubChem CID 51951606) has the molecular formula C16H16ClN5O3 and a molecular weight of 361.79 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-1,3-dimethyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 51951606 |
| Molecular Formula | C16H16ClN5O3 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 5-chloro-1,3-dimethyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(Cl)c1C(=O)Nc1cccc([C@]2(C)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C16H16ClN5O3/c1-8-11(12(17)22(3)21-8)13(23)18-10-6-4-5-9(7-10)16(2)14(24)19-15(25)20-16/h4-7H,1-3H3,(H,18,23)(H2,19,20,24,25)/t16-/m0/s1 |
| InChIKey | KQEKLGOTLNGSQW-INIZCTEOSA-N |
| XLogP | 1.69 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|