C18H21N5OS — CID 51952099
(2R)-N,N-dimethyl-2-phenyl-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 51952099) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-phenyl-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | (2R)-N,N-dimethyl-2-phenyl-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 51952099 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2R)-N,N-dimethyl-2-phenyl-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nc2nc(S[C@@H](C(=O)N(C)C)c3ccccc3)nn2c(C)c1C |
| InChI | InChI=1S/C18H21N5OS/c1-11-12(2)19-17-20-18(21-23(17)13(11)3)25-15(16(24)22(4)5)14-9-7-6-8-10-14/h6-10,15H,1-5H3/t15-/m1/s1 |
| InChIKey | DIONXCXYJJEIPI-OAHLLOKOSA-N |
| XLogP | 2.97 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |