C20H25BrN2O3 — CID 51952483
4-(2-bromophenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butanamide (PubChem CID 51952483) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butanamide.
| Compound Name | 4-(2-bromophenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butanamide |
|---|---|
| PubChem CID | 51952483 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-(2-bromophenoxy)-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1Br)NC[C@@H](c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C20H25BrN2O3/c21-16-7-1-2-8-18(16)25-14-6-10-20(24)22-15-17(19-9-5-13-26-19)23-11-3-4-12-23/h1-2,5,7-9,13,17H,3-4,6,10-12,14-15H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | WDIVMWBXCUXOJH-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|