C19H22FNO3S — CID 51954078
(2S)-N-[(3-fluorophenyl)methyl]-N-methyl-2-[(3-methylphenyl)methylsulfonyl]propanamide (PubChem CID 51954078) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is (2S)-N-[(3-fluorophenyl)methyl]-N-methyl-2-[(3-methylphenyl)methylsulfonyl]propanamide.
| Compound Name | (2S)-N-[(3-fluorophenyl)methyl]-N-methyl-2-[(3-methylphenyl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 51954078 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (2S)-N-[(3-fluorophenyl)methyl]-N-methyl-2-[(3-methylphenyl)methylsulfonyl]propanamide |
| SMILES | Cc1cccc(CS(=O)(=O)[C@@H](C)C(=O)N(C)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H22FNO3S/c1-14-6-4-8-17(10-14)13-25(23,24)15(2)19(22)21(3)12-16-7-5-9-18(20)11-16/h4-11,15H,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | RATBFSPWCAPNLK-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |