C24H32N4O3 — CID 51954210
(3S)-3-acetamido-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 51954210) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is (3S)-3-acetamido-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | (3S)-3-acetamido-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 51954210 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (3S)-3-acetamido-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc([C@H](CC(=O)NCc2ccc(N3CCCCCC3)nc2)NC(C)=O)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-18(29)27-22(20-8-10-21(31-2)11-9-20)15-24(30)26-17-19-7-12-23(25-16-19)28-13-5-3-4-6-14-28/h7-12,16,22H,3-6,13-15,17H2,1-2H3,(H,26,30)(H,27,29)/t22-/m0/s1 |
| InChIKey | BMIROQDUQZCVPE-QFIPXVFZSA-N |
| XLogP | 3.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |