C22H25N3O3 — CID 5195626
1-(2,5-dimethylphenyl)-N-(2-methoxyethyl)-3-(4-methoxyphenyl)pyrazole-5-carboxamide (PubChem CID 5195626) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-(2-methoxyethyl)-3-(4-methoxyphenyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)-N-(2-methoxyethyl)-3-(4-methoxyphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5195626 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-(2-methoxyethyl)-3-(4-methoxyphenyl)pyrazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccc(OC)cc2)nn1-c1cc(C)ccc1C |
| InChI | InChI=1S/C22H25N3O3/c1-15-5-6-16(2)20(13-15)25-21(22(26)23-11-12-27-3)14-19(24-25)17-7-9-18(28-4)10-8-17/h5-10,13-14H,11-12H2,1-4H3,(H,23,26) |
| InChIKey | CDQHRMWLLWFGBM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|