C23H25N5O2 — CID 51956656
6-[(1R)-1-phenylethoxy]-N-(1-pyrimidin-2-ylpiperidin-4-yl)pyridine-3-carboxamide (PubChem CID 51956656) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 6-[(1R)-1-phenylethoxy]-N-(1-pyrimidin-2-ylpiperidin-4-yl)pyridine-3-carboxamide.
| Compound Name | 6-[(1R)-1-phenylethoxy]-N-(1-pyrimidin-2-ylpiperidin-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51956656 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 6-[(1R)-1-phenylethoxy]-N-(1-pyrimidin-2-ylpiperidin-4-yl)pyridine-3-carboxamide |
| SMILES | C[C@@H](Oc1ccc(C(=O)NC2CCN(c3ncccn3)CC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H25N5O2/c1-17(18-6-3-2-4-7-18)30-21-9-8-19(16-26-21)22(29)27-20-10-14-28(15-11-20)23-24-12-5-13-25-23/h2-9,12-13,16-17,20H,10-11,14-15H2,1H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | XUAJLOVBGZBKDE-QGZVFWFLSA-N |
| XLogP | 3.41 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |