C20H27N3O2 — CID 51956887
1-[[3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]phenyl]methyl]piperidine-4-carboxamide (PubChem CID 51956887) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[[3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51956887 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[[3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]phenyl]methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2cccc(NC(=O)C[C@@H]3C=CCC3)c2)CC1 |
| InChI | InChI=1S/C20H27N3O2/c21-20(25)17-8-10-23(11-9-17)14-16-6-3-7-18(12-16)22-19(24)13-15-4-1-2-5-15/h1,3-4,6-7,12,15,17H,2,5,8-11,13-14H2,(H2,21,25)(H,22,24)/t15-/m1/s1 |
| InChIKey | YBHCKRYIDJXLRW-OAHLLOKOSA-N |
| XLogP | 2.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|