C20H23N3O5S — CID 51958283
N-[2-(2,3-dimethylanilino)-2-oxoethyl]-5-nitro-N-[[(2S)-oxolan-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 51958283) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[2-(2,3-dimethylanilino)-2-oxoethyl]-5-nitro-N-[[(2S)-oxolan-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(2,3-dimethylanilino)-2-oxoethyl]-5-nitro-N-[[(2S)-oxolan-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 51958283 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[2-(2,3-dimethylanilino)-2-oxoethyl]-5-nitro-N-[[(2S)-oxolan-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)c2csc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C20H23N3O5S/c1-13-5-3-7-17(14(13)2)21-18(24)11-22(10-16-6-4-8-28-16)20(25)15-9-19(23(26)27)29-12-15/h3,5,7,9,12,16H,4,6,8,10-11H2,1-2H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | CCWHNPHLKIUZFO-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|