C35H35N3O3 — CID 5195927
7-[3-[benzyl(methyl)amino]propylamino]-3-tert-butyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione (PubChem CID 5195927) has the molecular formula C35H35N3O3 and a molecular weight of 545.68 g/mol. Its IUPAC name is 7-[3-[benzyl(methyl)amino]propylamino]-3-tert-butyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione.
| Compound Name | 7-[3-[benzyl(methyl)amino]propylamino]-3-tert-butyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
|---|---|
| PubChem CID | 5195927 |
| Molecular Formula | C35H35N3O3 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 7-[3-[benzyl(methyl)amino]propylamino]-3-tert-butyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
| SMILES | CN(CCCNc1cc2oc3cc(C(C)(C)C)ccc3[nH]c2c2c(=O)c3ccccc3c(=O)c12)Cc1ccccc1 |
| InChI | InChI=1S/C35H35N3O3/c1-35(2,3)23-15-16-26-28(19-23)41-29-20-27(36-17-10-18-38(4)21-22-11-6-5-7-12-22)30-31(32(29)37-26)34(40)25-14-9-8-13-24(25)33(30)39/h5-9,11-16,19-20,36-37H,10,17-18,21H2,1-4H3 |
| InChIKey | DPKKZTPXANSIMJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|