C23H25N3O2S — CID 5196183
13-ethyl-13-methyl-6-(4-methylphenyl)-5-prop-2-enylsulfanyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9-tetraen-7-one (PubChem CID 5196183) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 13-ethyl-13-methyl-6-(4-methylphenyl)-5-prop-2-enylsulfanyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9-tetraen-7-one.
| Compound Name | 13-ethyl-13-methyl-6-(4-methylphenyl)-5-prop-2-enylsulfanyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9-tetraen-7-one |
|---|---|
| PubChem CID | 5196183 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 13-ethyl-13-methyl-6-(4-methylphenyl)-5-prop-2-enylsulfanyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,9-tetraen-7-one |
| SMILES | C=CCSc1nc2nc3c(cc2c(=O)n1-c1ccc(C)cc1)COC(C)(CC)C3 |
| InChI | InChI=1S/C23H25N3O2S/c1-5-11-29-22-25-20-18(21(27)26(22)17-9-7-15(3)8-10-17)12-16-14-28-23(4,6-2)13-19(16)24-20/h5,7-10,12H,1,6,11,13-14H2,2-4H3 |
| InChIKey | JNZNZRMZWFLBHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|