C22H26N4O3S — CID 51962353
(3S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide (PubChem CID 51962353) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is (3S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51962353 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (3S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(CCC(=O)N1CCC[C@H](C(=O)Nc2nncs2)C1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H26N4O3S/c27-19(17-8-7-15-4-1-2-5-16(15)12-17)9-10-20(28)26-11-3-6-18(13-26)21(29)24-22-25-23-14-30-22/h7-8,12,14,18H,1-6,9-11,13H2,(H,24,25,29)/t18-/m0/s1 |
| InChIKey | UUNAGGOWCRSRGW-SFHVURJKSA-N |
| XLogP | 3.26 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |