About dimethyl 3-methylpentanedioate
dimethyl 3-methylpentanedioate (PubChem CID 519624) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is dimethyl 3-methylpentanedioate.
Molecular Properties
| Compound Name | dimethyl 3-methylpentanedioate |
| PubChem CID | 519624 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | dimethyl 3-methylpentanedioate |
| SMILES | COC(=O)CC(C)CC(=O)OC |
| InChI | InChI=1S/C8H14O4/c1-6(4-7(9)11-2)5-8(10)12-3/h6H,4-5H2,1-3H3 |
| InChIKey | YIJLMTNDXYVGPQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 3-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-methylpentanedioate?
The IUPAC name of dimethyl 3-methylpentanedioate (CID 519624) is dimethyl 3-methylpentanedioate.
What is the SMILES notation for dimethyl 3-methylpentanedioate?
The canonical SMILES for dimethyl 3-methylpentanedioate is COC(=O)CC(C)CC(=O)OC.
What is the InChIKey of dimethyl 3-methylpentanedioate?
The InChIKey is YIJLMTNDXYVGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-6(4-7(9)11-2)5-8(10)12-3/h6H,4-5H2,1-3H3.
What are the key properties of dimethyl 3-methylpentanedioate?
dimethyl 3-methylpentanedioate has a molecular weight of 174.20 g/mol, XLogP of 0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-methylpentanedioate is sourced from PubChem (CID 519624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).