About 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene
1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene (PubChem CID 51963657) has the molecular formula C16H24O4S
and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene.
Molecular Properties
| Compound Name | 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene |
| PubChem CID | 51963657 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene |
| SMILES | COc1cccc(S(=O)(=O)CCO[C@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C16H24O4S/c1-13-6-3-4-9-16(13)20-10-11-21(17,18)15-8-5-7-14(12-15)19-2/h5,7-8,12-13,16H,3-4,6,9-11H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | VMTNFAVJUSKIAK-CJNGLKHVSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene?
The IUPAC name of 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene (CID 51963657) is 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene.
What is the SMILES notation for 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene?
The canonical SMILES for 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene is COc1cccc(S(=O)(=O)CCO[C@H]2CCCC[C@H]2C)c1.
What is the InChIKey of 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene?
The InChIKey is VMTNFAVJUSKIAK-CJNGLKHVSA-N. The full InChI is InChI=1S/C16H24O4S/c1-13-6-3-4-9-16(13)20-10-11-21(17,18)15-8-5-7-14(12-15)19-2/h5,7-8,12-13,16H,3-4,6,9-11H2,1-2H3/t13-,16+/m1/s1.
What are the key properties of 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene?
1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene has a molecular weight of 312.43 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene is sourced from PubChem (CID 51963657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).