C16H24O4S — CID 51963657
1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene (PubChem CID 51963657) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene.
| Compound Name | 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene |
|---|---|
| PubChem CID | 51963657 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-methoxy-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfonyl]benzene |
| SMILES | COc1cccc(S(=O)(=O)CCO[C@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C16H24O4S/c1-13-6-3-4-9-16(13)20-10-11-21(17,18)15-8-5-7-14(12-15)19-2/h5,7-8,12-13,16H,3-4,6,9-11H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | VMTNFAVJUSKIAK-CJNGLKHVSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |