About bis(2,4,6-trinitrophenyl)diazene
bis(2,4,6-trinitrophenyl)diazene (PubChem CID 519640) has the molecular formula C12H4N8O12
and a molecular weight of 452.21 g/mol. Its IUPAC name is bis(2,4,6-trinitrophenyl)diazene.
Molecular Properties
| Compound Name | bis(2,4,6-trinitrophenyl)diazene |
| PubChem CID | 519640 |
| Molecular Formula | C12H4N8O12 |
| Molecular Weight | 452.21 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | bis(2,4,6-trinitrophenyl)diazene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(/N=N/c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H4N8O12/c21-15(22)5-1-7(17(25)26)11(8(2-5)18(27)28)13-14-12-9(19(29)30)3-6(16(23)24)4-10(12)20(31)32/h1-4H/b14-13+ |
| InChIKey | PSDIVOYKWCKHLG-BUHFOSPRSA-N |
| XLogP | 3.55 |
| TPSA | 283.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2,4,6-trinitrophenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4,6-trinitrophenyl)diazene?
The IUPAC name of bis(2,4,6-trinitrophenyl)diazene (CID 519640) is bis(2,4,6-trinitrophenyl)diazene.
What is the SMILES notation for bis(2,4,6-trinitrophenyl)diazene?
The canonical SMILES for bis(2,4,6-trinitrophenyl)diazene is O=[N+]([O-])c1cc([N+](=O)[O-])c(/N=N/c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1.
What is the InChIKey of bis(2,4,6-trinitrophenyl)diazene?
The InChIKey is PSDIVOYKWCKHLG-BUHFOSPRSA-N. The full InChI is InChI=1S/C12H4N8O12/c21-15(22)5-1-7(17(25)26)11(8(2-5)18(27)28)13-14-12-9(19(29)30)3-6(16(23)24)4-10(12)20(31)32/h1-4H/b14-13+.
What are the key properties of bis(2,4,6-trinitrophenyl)diazene?
bis(2,4,6-trinitrophenyl)diazene has a molecular weight of 452.21 g/mol, XLogP of 3.55, 8 rotatable bonds, 0 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4,6-trinitrophenyl)diazene is sourced from PubChem (CID 519640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).