C26H29N3O8 — CID 51966359
(2S)-1-[[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 51966359) has the molecular formula C26H29N3O8 and a molecular weight of 511.53 g/mol. Its IUPAC name is (2S)-1-[[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 51966359 |
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (2S)-1-[[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OC[C@@H](O)CN(C[C@@H](O)c1ccc([N+](=O)[O-])cc1)C[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H29N3O8/c1-18-4-2-3-5-26(18)37-17-23(30)14-27(15-24(31)19-6-10-21(11-7-19)28(33)34)16-25(32)20-8-12-22(13-9-20)29(35)36/h2-13,23-25,30-32H,14-17H2,1H3/t23-,24-,25+/m0/s1 |
| InChIKey | OTNRKAVNOJELSV-CCDWMCETSA-N |
| XLogP | 3.32 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|