About [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea
[(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea (PubChem CID 51970780) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea.
Molecular Properties
| Compound Name | [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea |
| PubChem CID | 51970780 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea |
| SMILES | Cc1n[nH]c(C)c1[C@H](NC(N)=O)c1ccco1 |
| InChI | InChI=1S/C11H14N4O2/c1-6-9(7(2)15-14-6)10(13-11(12)16)8-4-3-5-17-8/h3-5,10H,1-2H3,(H,14,15)(H3,12,13,16)/t10-/m1/s1 |
| InChIKey | RBFOAOXUEBJMDS-SNVBAGLBSA-N |
| XLogP | 1.38 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea?
The IUPAC name of [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea (CID 51970780) is [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea.
What is the SMILES notation for [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea?
The canonical SMILES for [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea is Cc1n[nH]c(C)c1[C@H](NC(N)=O)c1ccco1.
What is the InChIKey of [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea?
The InChIKey is RBFOAOXUEBJMDS-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-6-9(7(2)15-14-6)10(13-11(12)16)8-4-3-5-17-8/h3-5,10H,1-2H3,(H,14,15)(H3,12,13,16)/t10-/m1/s1.
What are the key properties of [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea?
[(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea has a molecular weight of 234.26 g/mol, XLogP of 1.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-(furan-2-yl)methyl]urea is sourced from PubChem (CID 51970780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).