C21H25NO6S — CID 51971074
[(1S,2S,3S,4R,5R)-3-hydroxy-2-[[(1S)-1-phenylethyl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 51971074) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5R)-3-hydroxy-2-[[(1S)-1-phenylethyl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,3S,4R,5R)-3-hydroxy-2-[[(1S)-1-phenylethyl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 51971074 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(1S,2S,3S,4R,5R)-3-hydroxy-2-[[(1S)-1-phenylethyl]amino]-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H]3OC[C@@H](O3)[C@@H](N[C@@H](C)c3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H25NO6S/c1-13-8-10-16(11-9-13)29(24,25)28-20-19(23)18(17-12-26-21(20)27-17)22-14(2)15-6-4-3-5-7-15/h3-11,14,17-23H,12H2,1-2H3/t14-,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | DXIMAQSOGTXDBC-OYQCXUJZSA-N |
| XLogP | 1.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|