C17H15FN2O — CID 51971151
(2'S,3S)-2'-(3-fluorophenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 51971151) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is (2'S,3S)-2'-(3-fluorophenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3S)-2'-(3-fluorophenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 51971151 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2'S,3S)-2'-(3-fluorophenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2[C@]12CCN[C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C17H15FN2O/c18-12-5-3-4-11(10-12)15-17(8-9-19-15)13-6-1-2-7-14(13)20-16(17)21/h1-7,10,15,19H,8-9H2,(H,20,21)/t15-,17-/m0/s1 |
| InChIKey | NBKCFZMTICAELA-RDJZCZTQSA-N |
| XLogP | 2.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |