C29H25Cl2N5O — CID 5197298
6,7-dichloro-12,15,15-trimethyl-N-(4-phenyldiazenylphenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 5197298) has the molecular formula C29H25Cl2N5O and a molecular weight of 530.46 g/mol. Its IUPAC name is 6,7-dichloro-12,15,15-trimethyl-N-(4-phenyldiazenylphenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | 6,7-dichloro-12,15,15-trimethyl-N-(4-phenyldiazenylphenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 5197298 |
| Molecular Formula | C29H25Cl2N5O |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 6,7-dichloro-12,15,15-trimethyl-N-(4-phenyldiazenylphenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccc(/N=N/c4ccccc4)cc3)(c3nc4cc(Cl)c(Cl)cc4nc31)C2(C)C |
| InChI | InChI=1S/C29H25Cl2N5O/c1-27(2)28(3)13-14-29(27,25-24(28)33-22-15-20(30)21(31)16-23(22)34-25)26(37)32-17-9-11-19(12-10-17)36-35-18-7-5-4-6-8-18/h4-12,15-16H,13-14H2,1-3H3,(H,32,37)/b36-35+ |
| InChIKey | PDJGOUCJMONRFG-ULDVOPSXSA-N |
| XLogP | 8.32 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|