About (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one
(7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one (PubChem CID 51973940) has the molecular formula C17H13FN4O
and a molecular weight of 308.32 g/mol. Its IUPAC name is (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one.
Molecular Properties
| Compound Name | (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one |
| PubChem CID | 51973940 |
| Molecular Formula | C17H13FN4O |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one |
| SMILES | O=C1C[C@H](c2ccc(F)cc2)c2ncn(-c3cccnc3)c2N1 |
| InChI | InChI=1S/C17H13FN4O/c18-12-5-3-11(4-6-12)14-8-15(23)21-17-16(14)20-10-22(17)13-2-1-7-19-9-13/h1-7,9-10,14H,8H2,(H,21,23)/t14-/m1/s1 |
| InChIKey | ZRJUHJYZPIHPNO-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one?
The IUPAC name of (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one (CID 51973940) is (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one.
What is the SMILES notation for (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one?
The canonical SMILES for (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one is O=C1C[C@H](c2ccc(F)cc2)c2ncn(-c3cccnc3)c2N1.
What is the InChIKey of (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one?
The InChIKey is ZRJUHJYZPIHPNO-CQSZACIVSA-N. The full InChI is InChI=1S/C17H13FN4O/c18-12-5-3-11(4-6-12)14-8-15(23)21-17-16(14)20-10-22(17)13-2-1-7-19-9-13/h1-7,9-10,14H,8H2,(H,21,23)/t14-/m1/s1.
What are the key properties of (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one?
(7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one has a molecular weight of 308.32 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-(4-fluorophenyl)-3-pyridin-3-yl-6,7-dihydro-4H-imidazo[4,5-b]pyridin-5-one is sourced from PubChem (CID 51973940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).