C6HBr4ClO — CID 519745
2,3,5,6-tetrabromo-4-chlorophenol (PubChem CID 519745) has the molecular formula C6HBr4ClO and a molecular weight of 444.14 g/mol. Its IUPAC name is 2,3,5,6-tetrabromo-4-chlorophenol.
| Compound Name | 2,3,5,6-tetrabromo-4-chlorophenol |
|---|---|
| PubChem CID | 519745 |
| Molecular Formula | C6HBr4ClO |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 439.64 |
| IUPAC Name | 2,3,5,6-tetrabromo-4-chlorophenol |
| SMILES | Oc1c(Br)c(Br)c(Cl)c(Br)c1Br |
| InChI | InChI=1S/C6HBr4ClO/c7-1-3(9)6(12)4(10)2(8)5(1)11/h12H |
| InChIKey | HHPGOBVKUZQECQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|