C18H19Cl2NOS — CID 5197742
2-(4-tert-butylphenyl)sulfanyl-N-(2,4-dichlorophenyl)acetamide (PubChem CID 5197742) has the molecular formula C18H19Cl2NOS and a molecular weight of 368.33 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 5197742 |
| Molecular Formula | C18H19Cl2NOS |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N-(2,4-dichlorophenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(SCC(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NOS/c1-18(2,3)12-4-7-14(8-5-12)23-11-17(22)21-16-9-6-13(19)10-15(16)20/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | WPHASNFOXVOXEP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |