About N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine
N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine (PubChem CID 5197757) has the molecular formula C5H8FN5O8
and a molecular weight of 285.14 g/mol. Its IUPAC name is N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine.
Molecular Properties
| Compound Name | N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine |
| PubChem CID | 5197757 |
| Molecular Formula | C5H8FN5O8 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine |
| SMILES | CC(CNCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H8FN5O8/c1-4(8(12)13,9(14)15)2-7-3-5(6,10(16)17)11(18)19/h7H,2-3H2,1H3 |
| InChIKey | AKPZIKMQOXNKID-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine?
The IUPAC name of N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine (CID 5197757) is N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine.
What is the SMILES notation for N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine?
The canonical SMILES for N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine is CC(CNCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine?
The InChIKey is AKPZIKMQOXNKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN5O8/c1-4(8(12)13,9(14)15)2-7-3-5(6,10(16)17)11(18)19/h7H,2-3H2,1H3.
What are the key properties of N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine?
N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine has a molecular weight of 285.14 g/mol, XLogP of -0.98, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoro-2,2-dinitroethyl)-2,2-dinitropropan-1-amine is sourced from PubChem (CID 5197757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).