C14H21BrN2O3S — CID 51979876
(2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide (PubChem CID 51979876) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide.
| Compound Name | (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 51979876 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccccc1Br)C(=O)N(C)C |
| InChI | InChI=1S/C14H21BrN2O3S/c1-10(2)9-12(14(18)17(3)4)16-21(19,20)13-8-6-5-7-11(13)15/h5-8,10,12,16H,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | ORNZPFHTHKURRX-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |