About (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide
(2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide (PubChem CID 51979876) has the molecular formula C14H21BrN2O3S
and a molecular weight of 377.30 g/mol. Its IUPAC name is (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide.
Molecular Properties
| Compound Name | (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide |
| PubChem CID | 51979876 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccccc1Br)C(=O)N(C)C |
| InChI | InChI=1S/C14H21BrN2O3S/c1-10(2)9-12(14(18)17(3)4)16-21(19,20)13-8-6-5-7-11(13)15/h5-8,10,12,16H,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | ORNZPFHTHKURRX-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide?
The IUPAC name of (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide (CID 51979876) is (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide.
What is the SMILES notation for (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide?
The canonical SMILES for (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide is CC(C)C[C@H](NS(=O)(=O)c1ccccc1Br)C(=O)N(C)C.
What is the InChIKey of (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide?
The InChIKey is ORNZPFHTHKURRX-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H21BrN2O3S/c1-10(2)9-12(14(18)17(3)4)16-21(19,20)13-8-6-5-7-11(13)15/h5-8,10,12,16H,9H2,1-4H3/t12-/m0/s1.
What are the key properties of (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide?
(2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide has a molecular weight of 377.30 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2-bromophenyl)sulfonylamino]-N,N,4-trimethylpentanamide is sourced from PubChem (CID 51979876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).