About 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide
2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide (PubChem CID 51979953) has the molecular formula C12H17BrFNO4S
and a molecular weight of 370.24 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide |
| PubChem CID | 51979953 |
| Molecular Formula | C12H17BrFNO4S |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C12H17BrFNO4S/c1-18-7-5-15(6-8-19-2)20(16,17)12-4-3-10(14)9-11(12)13/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | CERHCYXMPIUHPR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide?
The IUPAC name of 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide (CID 51979953) is 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide.
What is the SMILES notation for 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide?
The canonical SMILES for 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide is COCCN(CCOC)S(=O)(=O)c1ccc(F)cc1Br.
What is the InChIKey of 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide?
The InChIKey is CERHCYXMPIUHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrFNO4S/c1-18-7-5-15(6-8-19-2)20(16,17)12-4-3-10(14)9-11(12)13/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide?
2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide has a molecular weight of 370.24 g/mol, XLogP of 1.87, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-fluoro-N,N-bis(2-methoxyethyl)benzenesulfonamide is sourced from PubChem (CID 51979953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).