C16H17N3O3 — CID 51981221
(5S)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 51981221) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (5S)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51981221 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (5S)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)[C@@H]1NC(=O)N(Cc2coc(-c3ccccc3)n2)C1=O |
| InChI | InChI=1S/C16H17N3O3/c1-10(2)13-15(20)19(16(21)18-13)8-12-9-22-14(17-12)11-6-4-3-5-7-11/h3-7,9-10,13H,8H2,1-2H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | NVDQPKJDYGLJMR-ZDUSSCGKSA-N |
| XLogP | 2.42 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|