C13H17ClFN3O2 — CID 51981491
(2R)-2-[(2-chloro-4-fluorophenyl)carbamoylamino]-N-propylpropanamide (PubChem CID 51981491) has the molecular formula C13H17ClFN3O2 and a molecular weight of 301.75 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-4-fluorophenyl)carbamoylamino]-N-propylpropanamide.
| Compound Name | (2R)-2-[(2-chloro-4-fluorophenyl)carbamoylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 51981491 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2R)-2-[(2-chloro-4-fluorophenyl)carbamoylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H17ClFN3O2/c1-3-6-16-12(19)8(2)17-13(20)18-11-5-4-9(15)7-10(11)14/h4-5,7-8H,3,6H2,1-2H3,(H,16,19)(H2,17,18,20)/t8-/m1/s1 |
| InChIKey | WMBSBZHLFOXWQK-MRVPVSSYSA-N |
| XLogP | 2.52 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |