About N-phenyl-3,5-bis(trifluoromethyl)aniline
N-phenyl-3,5-bis(trifluoromethyl)aniline (PubChem CID 5198217) has the molecular formula C14H9F6N
and a molecular weight of 305.22 g/mol. Its IUPAC name is N-phenyl-3,5-bis(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-phenyl-3,5-bis(trifluoromethyl)aniline |
| PubChem CID | 5198217 |
| Molecular Formula | C14H9F6N |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-phenyl-3,5-bis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(Nc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F6N/c15-13(16,17)9-6-10(14(18,19)20)8-12(7-9)21-11-4-2-1-3-5-11/h1-8,21H |
| InChIKey | MBHKTLILAXTGER-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenyl-3,5-bis(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-3,5-bis(trifluoromethyl)aniline?
The IUPAC name of N-phenyl-3,5-bis(trifluoromethyl)aniline (CID 5198217) is N-phenyl-3,5-bis(trifluoromethyl)aniline.
What is the SMILES notation for N-phenyl-3,5-bis(trifluoromethyl)aniline?
The canonical SMILES for N-phenyl-3,5-bis(trifluoromethyl)aniline is FC(F)(F)c1cc(Nc2ccccc2)cc(C(F)(F)F)c1.
What is the InChIKey of N-phenyl-3,5-bis(trifluoromethyl)aniline?
The InChIKey is MBHKTLILAXTGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6N/c15-13(16,17)9-6-10(14(18,19)20)8-12(7-9)21-11-4-2-1-3-5-11/h1-8,21H.
What are the key properties of N-phenyl-3,5-bis(trifluoromethyl)aniline?
N-phenyl-3,5-bis(trifluoromethyl)aniline has a molecular weight of 305.22 g/mol, XLogP of 5.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-3,5-bis(trifluoromethyl)aniline is sourced from PubChem (CID 5198217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).