About 2-bromo-4,6-ditert-butylphenol
2-bromo-4,6-ditert-butylphenol (PubChem CID 519822) has the molecular formula C14H21BrO
and a molecular weight of 285.23 g/mol. Its IUPAC name is 2-bromo-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-bromo-4,6-ditert-butylphenol |
| PubChem CID | 519822 |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-bromo-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(Br)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H21BrO/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,16H,1-6H3 |
| InChIKey | DIWZVAHZEOFSLS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-ditert-butylphenol?
The IUPAC name of 2-bromo-4,6-ditert-butylphenol (CID 519822) is 2-bromo-4,6-ditert-butylphenol.
What is the SMILES notation for 2-bromo-4,6-ditert-butylphenol?
The canonical SMILES for 2-bromo-4,6-ditert-butylphenol is CC(C)(C)c1cc(Br)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-bromo-4,6-ditert-butylphenol?
The InChIKey is DIWZVAHZEOFSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrO/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,16H,1-6H3.
What are the key properties of 2-bromo-4,6-ditert-butylphenol?
2-bromo-4,6-ditert-butylphenol has a molecular weight of 285.23 g/mol, XLogP of 4.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-ditert-butylphenol is sourced from PubChem (CID 519822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).