About (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile
(4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile (PubChem CID 51982546) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile.
Molecular Properties
| Compound Name | (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile |
| PubChem CID | 51982546 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile |
| SMILES | CC(=O)C1=C(C)OC(N)=C(C#N)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-10(19)14-11(2)20-15(18)13(9-17)16(14,3)12-7-5-4-6-8-12/h4-8H,18H2,1-3H3/t16-/m1/s1 |
| InChIKey | SXPCKWJDNCTWTJ-MRXNPFEDSA-N |
| XLogP | 2.53 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile?
The IUPAC name of (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile (CID 51982546) is (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile.
What is the SMILES notation for (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile?
The canonical SMILES for (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile is CC(=O)C1=C(C)OC(N)=C(C#N)[C@@]1(C)c1ccccc1.
What is the InChIKey of (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile?
The InChIKey is SXPCKWJDNCTWTJ-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-10(19)14-11(2)20-15(18)13(9-17)16(14,3)12-7-5-4-6-8-12/h4-8H,18H2,1-3H3/t16-/m1/s1.
What are the key properties of (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile?
(4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile has a molecular weight of 268.32 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5-acetyl-2-amino-4,6-dimethyl-4-phenylpyran-3-carbonitrile is sourced from PubChem (CID 51982546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).